About O-ethyl 2-dibenzofuran-1-yloxypropanethioate
O-ethyl 2-dibenzofuran-1-yloxypropanethioate (PubChem CID 87312649) has the molecular formula C17H16O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is O-ethyl 2-dibenzofuran-1-yloxypropanethioate.
Molecular Properties
| Compound Name | O-ethyl 2-dibenzofuran-1-yloxypropanethioate |
| PubChem CID | 87312649 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | O-ethyl 2-dibenzofuran-1-yloxypropanethioate |
| SMILES | CCOC(=S)C(C)Oc1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C17H16O3S/c1-3-18-17(21)11(2)19-14-9-6-10-15-16(14)12-7-4-5-8-13(12)20-15/h4-11H,3H2,1-2H3 |
| InChIKey | BXPWMYROFKILJW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl 2-dibenzofuran-1-yloxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl 2-dibenzofuran-1-yloxypropanethioate?
The IUPAC name of O-ethyl 2-dibenzofuran-1-yloxypropanethioate (CID 87312649) is O-ethyl 2-dibenzofuran-1-yloxypropanethioate.
What is the SMILES notation for O-ethyl 2-dibenzofuran-1-yloxypropanethioate?
The canonical SMILES for O-ethyl 2-dibenzofuran-1-yloxypropanethioate is CCOC(=S)C(C)Oc1cccc2oc3ccccc3c12.
What is the InChIKey of O-ethyl 2-dibenzofuran-1-yloxypropanethioate?
The InChIKey is BXPWMYROFKILJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3S/c1-3-18-17(21)11(2)19-14-9-6-10-15-16(14)12-7-4-5-8-13(12)20-15/h4-11H,3H2,1-2H3.
What are the key properties of O-ethyl 2-dibenzofuran-1-yloxypropanethioate?
O-ethyl 2-dibenzofuran-1-yloxypropanethioate has a molecular weight of 300.38 g/mol, XLogP of 4.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl 2-dibenzofuran-1-yloxypropanethioate is sourced from PubChem (CID 87312649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).