C12H14O6 — CID 87313274
2-[1,2-di(prop-2-enoyloxy)ethyl]but-3-enoic acid (PubChem CID 87313274) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-[1,2-di(prop-2-enoyloxy)ethyl]but-3-enoic acid.
| Compound Name | 2-[1,2-di(prop-2-enoyloxy)ethyl]but-3-enoic acid |
|---|---|
| PubChem CID | 87313274 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-[1,2-di(prop-2-enoyloxy)ethyl]but-3-enoic acid |
| SMILES | C=CC(=O)OCC(OC(=O)C=C)C(C=C)C(=O)O |
| InChI | InChI=1S/C12H14O6/c1-4-8(12(15)16)9(18-11(14)6-3)7-17-10(13)5-2/h4-6,8-9H,1-3,7H2,(H,15,16) |
| InChIKey | IEERIFLDEHDJBP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|