C10H20N2O3 — CID 87316681
2-[2-hydroxyethyl-(prop-2-enylamino)amino]pentanoic acid (PubChem CID 87316681) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-(prop-2-enylamino)amino]pentanoic acid.
| Compound Name | 2-[2-hydroxyethyl-(prop-2-enylamino)amino]pentanoic acid |
|---|---|
| PubChem CID | 87316681 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-[2-hydroxyethyl-(prop-2-enylamino)amino]pentanoic acid |
| SMILES | C=CCNN(CCO)C(CCC)C(=O)O |
| InChI | InChI=1S/C10H20N2O3/c1-3-5-9(10(14)15)12(7-8-13)11-6-4-2/h4,9,11,13H,2-3,5-8H2,1H3,(H,14,15) |
| InChIKey | ARSRDMNYRGXEAZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|