C4H5F2NO — CID 87323503
3,3-difluoroazetidine-1-carbaldehyde (PubChem CID 87323503) has the molecular formula C4H5F2NO and a molecular weight of 121.09 g/mol. Its IUPAC name is 3,3-difluoroazetidine-1-carbaldehyde.
| Compound Name | 3,3-difluoroazetidine-1-carbaldehyde |
|---|---|
| PubChem CID | 87323503 |
| Molecular Formula | C4H5F2NO |
| Molecular Weight | 121.09 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 3,3-difluoroazetidine-1-carbaldehyde |
| SMILES | O=CN1CC(F)(F)C1 |
| InChI | InChI=1S/C4H5F2NO/c5-4(6)1-7(2-4)3-8/h3H,1-2H2 |
| InChIKey | INVJBYOXKDTRAB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.09 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|