C10H19NO — CID 176798064
3,3-di(propan-2-yl)azetidine-1-carbaldehyde (PubChem CID 176798064) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)azetidine-1-carbaldehyde.
| Compound Name | 3,3-di(propan-2-yl)azetidine-1-carbaldehyde |
|---|---|
| PubChem CID | 176798064 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3,3-di(propan-2-yl)azetidine-1-carbaldehyde |
| SMILES | CC(C)C1(C(C)C)CN(C=O)C1 |
| InChI | InChI=1S/C10H19NO/c1-8(2)10(9(3)4)5-11(6-10)7-12/h7-9H,5-6H2,1-4H3 |
| InChIKey | CLJVFAKMGKQKDQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|