About 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol
2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol (PubChem CID 87325012) has the molecular formula C8H15ClO5
and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol |
| PubChem CID | 87325012 |
| Molecular Formula | C8H15ClO5 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol |
| SMILES | C=C(Cl)C(=O)O.OCCC(CO)CO |
| InChI | InChI=1S/C5H12O3.C3H3ClO2/c6-2-1-5(3-7)4-8;1-2(4)3(5)6/h5-8H,1-4H2;1H2,(H,5,6) |
| InChIKey | FMQMKPPKWSVTFW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol?
The IUPAC name of 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol (CID 87325012) is 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol.
What is the SMILES notation for 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol?
The canonical SMILES for 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol is C=C(Cl)C(=O)O.OCCC(CO)CO.
What is the InChIKey of 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol?
The InChIKey is FMQMKPPKWSVTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3.C3H3ClO2/c6-2-1-5(3-7)4-8;1-2(4)3(5)6/h5-8H,1-4H2;1H2,(H,5,6).
What are the key properties of 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol?
2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol has a molecular weight of 226.66 g/mol, XLogP of -0.21, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroprop-2-enoic acid;2-(hydroxymethyl)butane-1,4-diol is sourced from PubChem (CID 87325012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).