C5H15O6PS — CID 87966428
2-(hydroxymethyl)butane-1,4-diol;trihydroxy(sulfanylidene)-λ5-phosphane (PubChem CID 87966428) has the molecular formula C5H15O6PS and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-(hydroxymethyl)butane-1,4-diol;trihydroxy(sulfanylidene)-λ5-phosphane.
| Compound Name | 2-(hydroxymethyl)butane-1,4-diol;trihydroxy(sulfanylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 87966428 |
| Molecular Formula | C5H15O6PS |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(hydroxymethyl)butane-1,4-diol;trihydroxy(sulfanylidene)-λ5-phosphane |
| SMILES | OCCC(CO)CO.OP(O)(O)=S |
| InChI | InChI=1S/C5H12O3.H3O3PS/c6-2-1-5(3-7)4-8;1-4(2,3)5/h5-8H,1-4H2;(H3,1,2,3,5) |
| InChIKey | MXNJUKJUGRQLHR-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|