C26H29N3O5 — CID 87325638
N-benzyl-N-[4-(cyclopropylmethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 87325638) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-benzyl-N-[4-(cyclopropylmethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-N-[4-(cyclopropylmethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87325638 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-benzyl-N-[4-(cyclopropylmethoxyamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)C(=O)NOCC2CC2)N1 |
| InChI | InChI=1S/C26H29N3O5/c30-23-14-13-21(27-23)26(33)29(16-19-9-5-2-6-10-19)22(15-18-7-3-1-4-8-18)24(31)25(32)28-34-17-20-11-12-20/h1-10,20-22H,11-17H2,(H,27,30)(H,28,32) |
| InChIKey | XSRSNAIXBDSQJI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|