C11H18O3SSi — CID 87329485
2-[ethyl(dimethyl)silyl]-4-methylbenzenesulfonic acid (PubChem CID 87329485) has the molecular formula C11H18O3SSi and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-[ethyl(dimethyl)silyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[ethyl(dimethyl)silyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87329485 |
| Molecular Formula | C11H18O3SSi |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[ethyl(dimethyl)silyl]-4-methylbenzenesulfonic acid |
| SMILES | CC[Si](C)(C)c1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C11H18O3SSi/c1-5-16(3,4)11-8-9(2)6-7-10(11)15(12,13)14/h6-8H,5H2,1-4H3,(H,12,13,14) |
| InChIKey | CWMGOJSIXLXBKO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|