C29H21F7N6O2 — CID 87330021
butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[8-(2-fluorophenyl)purin-1-yl]acetate (PubChem CID 87330021) has the molecular formula C29H21F7N6O2 and a molecular weight of 618.51 g/mol. Its IUPAC name is butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[8-(2-fluorophenyl)purin-1-yl]acetate.
| Compound Name | butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[8-(2-fluorophenyl)purin-1-yl]acetate |
|---|---|
| PubChem CID | 87330021 |
| Molecular Formula | C29H21F7N6O2 |
| Molecular Weight | 618.51 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[8-(2-fluorophenyl)purin-1-yl]acetate |
| SMILES | CCCCOC(=O)C(c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nn1)n1cnc2nc(-c3ccccc3F)nc-2c1 |
| InChI | InChI=1S/C29H21F7N6O2/c1-2-3-12-44-27(43)24(42-14-23-26(37-15-42)39-25(38-23)18-6-4-5-7-20(18)30)22-11-10-21(40-41-22)17-9-8-16(28(31,32)33)13-19(17)29(34,35)36/h4-11,13-15,24H,2-3,12H2,1H3 |
| InChIKey | UQCCUBDYOITKGI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|