C25H28F3N3O5S — CID 87331272
N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]benzenesulfonamide;2,2,2-trifluoroacetate (PubChem CID 87331272) has the molecular formula C25H28F3N3O5S and a molecular weight of 539.58 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]benzenesulfonamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]benzenesulfonamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331272 |
| Molecular Formula | C25H28F3N3O5S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]benzenesulfonamide;2,2,2-trifluoroacetate |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1ccccc1)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H27N3O3S.C2HF3O2/c1-18(27)11-5-2-10-16-21(26-30(28,29)20-14-8-4-9-15-20)23-24-17-22(25-23)19-12-6-3-7-13-19;3-2(4,5)1(6)7/h3-4,6-9,12-15,17,21,26H,2,5,10-11,16H2,1H3,(H,24,25);(H,6,7)/t21-;/m0./s1 |
| InChIKey | SMKIKPVZNNUQLN-BOXHHOBZSA-N |
| XLogP | 2.15 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|