C26H37F6N5O7S — CID 86627953
dimethyl-[2-[methyl-[[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]sulfamoyl]amino]ethyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 86627953) has the molecular formula C26H37F6N5O7S and a molecular weight of 677.67 g/mol. Its IUPAC name is dimethyl-[2-[methyl-[[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]sulfamoyl]amino]ethyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | dimethyl-[2-[methyl-[[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]sulfamoyl]amino]ethyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 86627953 |
| Molecular Formula | C26H37F6N5O7S |
| Molecular Weight | 677.67 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | dimethyl-[2-[methyl-[[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]sulfamoyl]amino]ethyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)N(C)CC[NH+](C)C)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H35N5O3S.2C2HF3O2/c1-18(28)11-7-5-10-14-20(25-31(29,30)27(4)16-15-26(2)3)22-23-17-21(24-22)19-12-8-6-9-13-19;2*3-2(4,5)1(6)7/h6,8-9,12-13,17,20,25H,5,7,10-11,14-16H2,1-4H3,(H,23,24);2*(H,6,7)/t20-;;/m0../s1 |
| InChIKey | NITRXWRJLXMOAD-FJSYBICCSA-N |
| XLogP | -1.62 |
| TPSA | 180.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.67 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|