C34H40F6N4O6 — CID 87331525
N-[1-(4,5-diphenyl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331525) has the molecular formula C34H40F6N4O6 and a molecular weight of 714.70 g/mol. Its IUPAC name is N-[1-(4,5-diphenyl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | N-[1-(4,5-diphenyl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331525 |
| Molecular Formula | C34H40F6N4O6 |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | N-[1-(4,5-diphenyl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CC(=O)CCCCCC(NC(=O)C1CC[NH+](C)CC1)C1=NC(c2ccccc2)=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H38N4O2.2C2HF3O2/c1-22(35)12-6-3-11-17-26(31-30(36)25-18-20-34(2)21-19-25)29-32-27(23-13-7-4-8-14-23)28(33-29)24-15-9-5-10-16-24;2*3-2(4,5)1(6)7/h4-5,7-10,13-16,25-26H,3,6,11-12,17-21H2,1-2H3,(H,31,36)(H,32,33);2*(H,6,7) |
| InChIKey | UHHVKUSXEICWSP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|