C29H37F6N5O7 — CID 87331299
N-[(1S)-7-(methoxyamino)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)heptyl]-1-azoniabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331299) has the molecular formula C29H37F6N5O7 and a molecular weight of 681.63 g/mol. Its IUPAC name is N-[(1S)-7-(methoxyamino)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)heptyl]-1-azoniabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | N-[(1S)-7-(methoxyamino)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)heptyl]-1-azoniabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331299 |
| Molecular Formula | C29H37F6N5O7 |
| Molecular Weight | 681.63 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | N-[(1S)-7-(methoxyamino)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)heptyl]-1-azoniabicyclo[2.2.2]octane-4-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CONC(=O)CCCCC[C@H](NC(=O)C12CC[NH+](CC1)CC2)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H35N5O3.2C2HF3O2/c1-33-29-22(31)11-7-3-6-10-20(23-26-18-21(27-23)19-8-4-2-5-9-19)28-24(32)25-12-15-30(16-13-25)17-14-25;2*3-2(4,5)1(6)7/h2,4-5,8-9,18,20H,3,6-7,10-17H2,1H3,(H,26,27)(H,28,32)(H,29,31);2*(H,6,7)/t20-;;/m0../s1 |
| InChIKey | AHVOGMHZEZYVDA-FJSYBICCSA-N |
| XLogP | -1.26 |
| TPSA | 181.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.63 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|