C28H36F6N4O6 — CID 87331829
1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331829) has the molecular formula C28H36F6N4O6 and a molecular weight of 638.61 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331829 |
| Molecular Formula | C28H36F6N4O6 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)octyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CC[NH+](C)CC1)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H34N4O2.2C2HF3O2/c1-18(29)9-5-3-8-12-21(27-24(30)20-13-15-28(2)16-14-20)23-25-17-22(26-23)19-10-6-4-7-11-19;2*3-2(4,5)1(6)7/h4,6-7,10-11,17,20-21H,3,5,8-9,12-16H2,1-2H3,(H,25,26)(H,27,30);2*(H,6,7)/t21-;;/m0../s1 |
| InChIKey | YSEZHIXISNQRMG-FGJQBABTSA-N |
| XLogP | -0.49 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|