C29H31F6N5O6S — CID 87331253
2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]acetamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87331253) has the molecular formula C29H31F6N5O6S and a molecular weight of 691.65 g/mol. Its IUPAC name is 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]acetamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]acetamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331253 |
| Molecular Formula | C29H31F6N5O6S |
| Molecular Weight | 691.65 g/mol |
| Exact Mass | 691.19 |
| IUPAC Name | 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]acetamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CC1=C[N+]2=CCSC2=N1)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H29N5O2S.2C2HF3O2/c1-2-20(31)11-7-4-8-12-21(24-26-16-22(29-24)18-9-5-3-6-10-18)28-23(32)15-19-17-30-13-14-33-25(30)27-19;2*3-2(4,5)1(6)7/h3,5-6,9-10,13,16-17,21H,2,4,7-8,11-12,14-15H2,1H3,(H-,26,28,29,32);2*(H,6,7)/t21-;;/m0../s1 |
| InChIKey | YCVWROHWVDEDNE-FGJQBABTSA-N |
| XLogP | 1.40 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|