C25H30N5O2S+ — CID 87331254
2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide (PubChem CID 87331254) has the molecular formula C25H30N5O2S+ and a molecular weight of 464.62 g/mol. Its IUPAC name is 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide.
| Compound Name | 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide |
|---|---|
| PubChem CID | 87331254 |
| Molecular Formula | C25H30N5O2S+ |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-(2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]acetamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CC1=C[N+]2=CCSC2=N1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C25H29N5O2S/c1-2-20(31)11-7-4-8-12-21(24-26-16-22(29-24)18-9-5-3-6-10-18)28-23(32)15-19-17-30-13-14-33-25(30)27-19/h3,5-6,9-10,13,16-17,21H,2,4,7-8,11-12,14-15H2,1H3,(H-,26,28,29,32)/p+1/t21-/m0/s1 |
| InChIKey | HFXLQFJHBDKZHJ-NRFANRHFSA-O |
| XLogP | 4.59 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|