C27H33N3O2S — CID 87331579
N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 87331579) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 87331579 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)nonyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)c1csc2c1CCCC2)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C27H33N3O2S/c1-2-20(31)13-7-4-8-15-23(26-28-17-24(29-26)19-11-5-3-6-12-19)30-27(32)22-18-33-25-16-10-9-14-21(22)25/h3,5-6,11-12,17-18,23H,2,4,7-10,13-16H2,1H3,(H,28,29)(H,30,32)/t23-/m0/s1 |
| InChIKey | HPNCSBMUVWIQNU-QHCPKHFHSA-N |
| XLogP | 6.42 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|