C33H43F6N5O6 — CID 141254994
diethylamino-[3-[[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]amino]-3-oxopropyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 141254994) has the molecular formula C33H43F6N5O6 and a molecular weight of 719.72 g/mol. Its IUPAC name is diethylamino-[3-[[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]amino]-3-oxopropyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | diethylamino-[3-[[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]amino]-3-oxopropyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 141254994 |
| Molecular Formula | C33H43F6N5O6 |
| Molecular Weight | 719.72 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | diethylamino-[3-[[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]amino]-3-oxopropyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)CC[NH2+]N(CC)CC)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H41N5O2.2C2HF3O2/c1-4-25(35)14-8-7-9-15-26(32-28(36)18-19-31-34(5-2)6-3)29-30-21-27(33-29)24-17-16-22-12-10-11-13-23(22)20-24;2*3-2(4,5)1(6)7/h10-13,16-17,20-21,26,31H,4-9,14-15,18-19H2,1-3H3,(H,30,33)(H,32,36);2*(H,6,7)/t26-;;/m0../s1 |
| InChIKey | PIURFRFHUJBCCL-ROPHLPQBSA-N |
| XLogP | 1.34 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.72 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|