C33H41F6N5O7 — CID 87332186
N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxoheptyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87332186) has the molecular formula C33H41F6N5O7 and a molecular weight of 733.71 g/mol. Its IUPAC name is N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxoheptyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxoheptyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87332186 |
| Molecular Formula | C33H41F6N5O7 |
| Molecular Weight | 733.71 g/mol |
| Exact Mass | 733.29 |
| IUPAC Name | N-[(1S)-7-[methoxy(methyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxoheptyl]-1-methylpiperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CON(C)C(=O)CCCCC[C@H](NC(=O)C1CC[NH+](C)CC1)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H39N5O3.2C2HF3O2/c1-33-17-15-22(16-18-33)29(36)32-25(11-5-4-6-12-27(35)34(2)37-3)28-30-20-26(31-28)24-14-13-21-9-7-8-10-23(21)19-24;2*3-2(4,5)1(6)7/h7-10,13-14,19-20,22,25H,4-6,11-12,15-18H2,1-3H3,(H,30,31)(H,32,36);2*(H,6,7)/t25-;;/m0../s1 |
| InChIKey | YXLNGZMEVDANKD-WLOLSGMKSA-N |
| XLogP | 0.09 |
| TPSA | 172.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.71 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|