C29H36F3N5O4 — CID 87331697
(3S)-1-methyl-N-[(1S)-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxononyl]pyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate (PubChem CID 87331697) has the molecular formula C29H36F3N5O4 and a molecular weight of 575.63 g/mol. Its IUPAC name is (3S)-1-methyl-N-[(1S)-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxononyl]pyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | (3S)-1-methyl-N-[(1S)-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxononyl]pyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331697 |
| Molecular Formula | C29H36F3N5O4 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (3S)-1-methyl-N-[(1S)-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxononyl]pyrrolidin-1-ium-3-carboxamide;2,2,2-trifluoroacetate |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CC[NH+](C)C1)c1nc(-c2ccc3ccccc3c2)n[nH]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H35N5O2.C2HF3O2/c1-3-23(33)11-5-4-6-12-24(28-27(34)22-15-16-32(2)18-22)26-29-25(30-31-26)21-14-13-19-9-7-8-10-20(19)17-21;3-2(4,5)1(6)7/h7-10,13-14,17,22,24H,3-6,11-12,15-16,18H2,1-2H3,(H,28,34)(H,29,30,31);(H,6,7)/t22-,24-;/m0./s1 |
| InChIKey | BIBOGFVOXYZIDT-XYOGLKKJSA-N |
| XLogP | 2.55 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|