C27H32F3N6O4+ — CID 87332010
[(3S)-3-[[(1S)-7-amino-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxoheptyl]carbamoyl]-1-methylpyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87332010) has the molecular formula C27H32F3N6O4+ and a molecular weight of 561.59 g/mol. Its IUPAC name is [(3S)-3-[[(1S)-7-amino-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxoheptyl]carbamoyl]-1-methylpyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S)-3-[[(1S)-7-amino-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxoheptyl]carbamoyl]-1-methylpyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87332010 |
| Molecular Formula | C27H32F3N6O4+ |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | [(3S)-3-[[(1S)-7-amino-1-(3-naphthalen-2-yl-1H-1,2,4-triazol-5-yl)-7-oxoheptyl]carbamoyl]-1-methylpyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | C[N+]1(OC(=O)C(F)(F)F)CC[C@H](C(=O)N[C@@H](CCCCCC(N)=O)c2nc(-c3ccc4ccccc4c3)n[nH]2)C1 |
| InChI | InChI=1S/C27H31F3N6O4/c1-36(40-26(39)27(28,29)30)14-13-20(16-36)25(38)32-21(9-3-2-4-10-22(31)37)24-33-23(34-35-24)19-12-11-17-7-5-6-8-18(17)15-19/h5-8,11-12,15,20-21H,2-4,9-10,13-14,16H2,1H3,(H3-,31,32,33,34,35,37,38)/p+1/t20-,21-,36?/m0/s1 |
| InChIKey | NMHSGTNRYUBNGM-PTRIBTCBSA-O |
| XLogP | 3.70 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|