C26H32N4O3 — CID 67267522
1-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]azetidine-3-carboxamide (PubChem CID 67267522) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]azetidine-3-carboxamide.
| Compound Name | 1-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 67267522 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-methyl-N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]azetidine-3-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CN(C)C1)c1nnc(-c2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C26H32N4O3/c1-3-22(31)11-5-4-6-12-23(27-24(32)21-16-30(2)17-21)26-29-28-25(33-26)20-14-13-18-9-7-8-10-19(18)15-20/h7-10,13-15,21,23H,3-6,11-12,16-17H2,1-2H3,(H,27,32)/t23-/m0/s1 |
| InChIKey | KAZWODFKVPPEEL-QHCPKHFHSA-N |
| XLogP | 4.54 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|