C28H30N7O3+ — CID 67267518
N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]-2-(1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl)acetamide (PubChem CID 67267518) has the molecular formula C28H30N7O3+ and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]-2-(1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl)acetamide.
| Compound Name | N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]-2-(1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl)acetamide |
|---|---|
| PubChem CID | 67267518 |
| Molecular Formula | C28H30N7O3+ |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-[(1S)-1-(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)-7-oxononyl]-2-(1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-6-yl)acetamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)Cc1cnc2nc[nH][n+]2c1)c1nnc(-c2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C28H29N7O3/c1-2-23(36)10-4-3-5-11-24(32-25(37)14-19-16-29-28-30-18-31-35(28)17-19)27-34-33-26(38-27)22-13-12-20-8-6-7-9-21(20)15-22/h6-9,12-13,15-18,24H,2-5,10-11,14H2,1H3,(H,32,37)/p+1/t24-/m0/s1 |
| InChIKey | PZWCIIPLXNNBAO-DEOSSOPVSA-O |
| XLogP | 4.08 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|