C34H41F3N4O5 — CID 87331302
2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-9-methyl-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)decyl]acetamide;2,2,2-trifluoroacetate (PubChem CID 87331302) has the molecular formula C34H41F3N4O5 and a molecular weight of 642.72 g/mol. Its IUPAC name is 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-9-methyl-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)decyl]acetamide;2,2,2-trifluoroacetate.
| Compound Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-9-methyl-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)decyl]acetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331302 |
| Molecular Formula | C34H41F3N4O5 |
| Molecular Weight | 642.72 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-[(1S)-9-methyl-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)decyl]acetamide;2,2,2-trifluoroacetate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)CC(C)C)C3=NC=C(c4ccccc4)[NH2+]3)c2c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H40N4O3.C2HF3O2/c1-21(2)17-24(37)13-9-6-10-14-29(32-33-20-30(36-32)23-11-7-5-8-12-23)35-31(38)19-26-22(3)34-28-16-15-25(39-4)18-27(26)28;3-2(4,5)1(6)7/h5,7-8,11-12,15-16,18,20-21,29,34H,6,9-10,13-14,17,19H2,1-4H3,(H,33,36)(H,35,38);(H,6,7)/t29-;/m0./s1 |
| InChIKey | LTMWFWAITCDTHV-JMAPEOGHSA-N |
| XLogP | 4.35 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|