C28H34F6N4O7 — CID 87331715
(7S)-7-(1-azoniabicyclo[2.2.2]octane-4-carbonylamino)-7-(5-phenyl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) (PubChem CID 87331715) has the molecular formula C28H34F6N4O7 and a molecular weight of 652.59 g/mol. Its IUPAC name is (7S)-7-(1-azoniabicyclo[2.2.2]octane-4-carbonylamino)-7-(5-phenyl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate).
| Compound Name | (7S)-7-(1-azoniabicyclo[2.2.2]octane-4-carbonylamino)-7-(5-phenyl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87331715 |
| Molecular Formula | C28H34F6N4O7 |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | (7S)-7-(1-azoniabicyclo[2.2.2]octane-4-carbonylamino)-7-(5-phenyl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C(O)CCCCC[C@H](NC(=O)C12CC[NH+](CC1)CC2)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H32N4O3.2C2HF3O2/c29-21(30)10-6-2-5-9-19(22-25-17-20(26-22)18-7-3-1-4-8-18)27-23(31)24-11-14-28(15-12-24)16-13-24;2*3-2(4,5)1(6)7/h1,3-4,7-8,17,19H,2,5-6,9-16H2,(H,25,26)(H,27,31)(H,29,30);2*(H,6,7)/t19-;;/m0../s1 |
| InChIKey | WDFHPLIUGANODW-TXEPZDRESA-N |
| XLogP | -0.85 |
| TPSA | 180.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|