C31H36F6N4O7 — CID 87332158
(7S)-7-[(1-methylpiperidin-1-ium-4-carbonyl)amino]-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) (PubChem CID 87332158) has the molecular formula C31H36F6N4O7 and a molecular weight of 690.64 g/mol. Its IUPAC name is (7S)-7-[(1-methylpiperidin-1-ium-4-carbonyl)amino]-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate).
| Compound Name | (7S)-7-[(1-methylpiperidin-1-ium-4-carbonyl)amino]-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87332158 |
| Molecular Formula | C31H36F6N4O7 |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | (7S)-7-[(1-methylpiperidin-1-ium-4-carbonyl)amino]-7-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)heptanoic acid;bis(2,2,2-trifluoroacetate) |
| SMILES | C[NH+]1CCC(C(=O)N[C@@H](CCCCCC(=O)O)C2=NC=C(c3ccc4ccccc4c3)[NH2+]2)CC1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H34N4O3.2C2HF3O2/c1-31-15-13-20(14-16-31)27(34)30-23(9-3-2-4-10-25(32)33)26-28-18-24(29-26)22-12-11-19-7-5-6-8-21(19)17-22;2*3-2(4,5)1(6)7/h5-8,11-12,17-18,20,23H,2-4,9-10,13-16H2,1H3,(H,28,29)(H,30,34)(H,32,33);2*(H,6,7)/t23-;;/m0../s1 |
| InChIKey | ZSKYZXIHVSFWKF-IFUPQEAVSA-N |
| XLogP | 0.16 |
| TPSA | 180.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|