C28H33F3N4O5 — CID 87331330
N',N'-dimethyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]oxamide;2,2,2-trifluoroacetate (PubChem CID 87331330) has the molecular formula C28H33F3N4O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]oxamide;2,2,2-trifluoroacetate.
| Compound Name | N',N'-dimethyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]oxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331330 |
| Molecular Formula | C28H33F3N4O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N',N'-dimethyl-N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]oxamide;2,2,2-trifluoroacetate |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C(=O)N(C)C)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H32N4O3.C2HF3O2/c1-4-21(31)12-6-5-7-13-22(29-25(32)26(33)30(2)3)24-27-17-23(28-24)20-15-14-18-10-8-9-11-19(18)16-20;3-2(4,5)1(6)7/h8-11,14-17,22H,4-7,12-13H2,1-3H3,(H,27,28)(H,29,32);(H,6,7)/t22-;/m0./s1 |
| InChIKey | WPXWXSIWZLDDPQ-FTBISJDPSA-N |
| XLogP | 1.91 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|