C29H36F3N3O5 — CID 67269011
tert-butyl N-[(1S)-1-(1-methyl-4-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]carbamate;2,2,2-trifluoroacetate (PubChem CID 67269011) has the molecular formula C29H36F3N3O5 and a molecular weight of 563.62 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(1-methyl-4-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]carbamate;2,2,2-trifluoroacetate.
| Compound Name | tert-butyl N-[(1S)-1-(1-methyl-4-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]carbamate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67269011 |
| Molecular Formula | C29H36F3N3O5 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | tert-butyl N-[(1S)-1-(1-methyl-4-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxooctyl]carbamate;2,2,2-trifluoroacetate |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)OC(C)(C)C)C1=NC(c2ccc3ccccc3c2)=C[NH+]1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H35N3O3.C2HF3O2/c1-19(31)11-7-6-8-14-23(29-26(32)33-27(2,3)4)25-28-24(18-30(25)5)22-16-15-20-12-9-10-13-21(20)17-22;3-2(4,5)1(6)7/h9-10,12-13,15-18,23H,6-8,11,14H2,1-5H3,(H,29,32);(H,6,7)/t23-;/m0./s1 |
| InChIKey | CLPUDQFTCGIWLA-BQAIUKQQSA-N |
| XLogP | 3.80 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|