C26H33F3N4O5S — CID 87331383
2-[(1S)-1-(dimethylsulfamoylamino)-7-oxononyl]-5-naphthalen-2-yl-1H-imidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 87331383) has the molecular formula C26H33F3N4O5S and a molecular weight of 570.63 g/mol. Its IUPAC name is 2-[(1S)-1-(dimethylsulfamoylamino)-7-oxononyl]-5-naphthalen-2-yl-1H-imidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 2-[(1S)-1-(dimethylsulfamoylamino)-7-oxononyl]-5-naphthalen-2-yl-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331383 |
| Molecular Formula | C26H33F3N4O5S |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 2-[(1S)-1-(dimethylsulfamoylamino)-7-oxononyl]-5-naphthalen-2-yl-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCC(=O)CCCCC[C@H](NS(=O)(=O)N(C)C)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H32N4O3S.C2HF3O2/c1-4-21(29)12-6-5-7-13-22(27-32(30,31)28(2)3)24-25-17-23(26-24)20-15-14-18-10-8-9-11-19(18)16-20;3-2(4,5)1(6)7/h8-11,14-17,22,27H,4-7,12-13H2,1-3H3,(H,25,26);(H,6,7)/t22-;/m0./s1 |
| InChIKey | MVLIGSXHDCSBOT-FTBISJDPSA-N |
| XLogP | 2.11 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|