C26H30F3N3O4 — CID 87331255
N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]acetamide;2,2,2-trifluoroacetate (PubChem CID 87331255) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]acetamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]acetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87331255 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-1-ium-2-yl)-7-oxononyl]acetamide;2,2,2-trifluoroacetate |
| SMILES | CCC(=O)CCCCC[C@H](NC(C)=O)C1=NC=C(c2ccc3ccccc3c2)[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H29N3O2.C2HF3O2/c1-3-21(29)11-5-4-6-12-22(26-17(2)28)24-25-16-23(27-24)20-14-13-18-9-7-8-10-19(18)15-20;3-2(4,5)1(6)7/h7-10,13-16,22H,3-6,11-12H2,1-2H3,(H,25,27)(H,26,28);(H,6,7)/t22-;/m0./s1 |
| InChIKey | HQAQYPKHSYLYRD-FTBISJDPSA-N |
| XLogP | 2.85 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|