C29H38F6N4O6 — CID 87332059
1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) (PubChem CID 87332059) has the molecular formula C29H38F6N4O6 and a molecular weight of 652.63 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate).
| Compound Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 87332059 |
| Molecular Formula | C29H38F6N4O6 |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 1-methyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-1-ium-2-yl)nonyl]piperidin-1-ium-4-carboxamide;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CC[NH+](C)CC1)C1=NC=C(c2ccccc2)[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H36N4O2.2C2HF3O2/c1-3-21(30)12-8-5-9-13-22(28-25(31)20-14-16-29(2)17-15-20)24-26-18-23(27-24)19-10-6-4-7-11-19;2*3-2(4,5)1(6)7/h4,6-7,10-11,18,20,22H,3,5,8-9,12-17H2,1-2H3,(H,26,27)(H,28,31);2*(H,6,7)/t22-;;/m0../s1 |
| InChIKey | XHZXWOYWEQFKSK-IKXQUJFKSA-N |
| XLogP | -0.10 |
| TPSA | 159.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|