C19H16N8 — CID 87331408
6-(5-cyclopropyl-1H-pyrazol-3-yl)-5-ethynyl-2-N-(1H-indazol-5-yl)pyrimidine-2,4-diamine (PubChem CID 87331408) has the molecular formula C19H16N8 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-(5-cyclopropyl-1H-pyrazol-3-yl)-5-ethynyl-2-N-(1H-indazol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(5-cyclopropyl-1H-pyrazol-3-yl)-5-ethynyl-2-N-(1H-indazol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87331408 |
| Molecular Formula | C19H16N8 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6-(5-cyclopropyl-1H-pyrazol-3-yl)-5-ethynyl-2-N-(1H-indazol-5-yl)pyrimidine-2,4-diamine |
| SMILES | C#Cc1c(N)nc(Nc2ccc3[nH]ncc3c2)nc1-c1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C19H16N8/c1-2-13-17(16-8-15(26-27-16)10-3-4-10)23-19(24-18(13)20)22-12-5-6-14-11(7-12)9-21-25-14/h1,5-10H,3-4H2,(H,21,25)(H,26,27)(H3,20,22,23,24) |
| InChIKey | FUEJAWNGQYUZJI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|