C18H17N7O — CID 163633208
8-cyclopentyl-2-(1H-indazol-5-ylamino)pteridin-7-one (PubChem CID 163633208) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 8-cyclopentyl-2-(1H-indazol-5-ylamino)pteridin-7-one.
| Compound Name | 8-cyclopentyl-2-(1H-indazol-5-ylamino)pteridin-7-one |
|---|---|
| PubChem CID | 163633208 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 8-cyclopentyl-2-(1H-indazol-5-ylamino)pteridin-7-one |
| SMILES | O=c1cnc2cnc(Nc3ccc4[nH]ncc4c3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C18H17N7O/c26-16-10-19-15-9-20-18(23-17(15)25(16)13-3-1-2-4-13)22-12-5-6-14-11(7-12)8-21-24-14/h5-10,13H,1-4H2,(H,21,24)(H,20,22,23) |
| InChIKey | HXWVGVJPZWPZCY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |