C26H33N7O3 — CID 175983867
tert-butyl 2-[4-[(8-cyclopentyl-7-oxopteridin-2-yl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 175983867) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[(8-cyclopentyl-7-oxopteridin-2-yl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[(8-cyclopentyl-7-oxopteridin-2-yl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175983867 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | tert-butyl 2-[4-[(8-cyclopentyl-7-oxopteridin-2-yl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1c1ccc(Nc2ncc3ncc(=O)n(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C26H33N7O3/c1-26(2,3)36-25(35)32-13-12-27-15-21(32)17-8-10-18(11-9-17)30-24-29-14-20-23(31-24)33(22(34)16-28-20)19-6-4-5-7-19/h8-11,14,16,19,21,27H,4-7,12-13,15H2,1-3H3,(H,29,30,31) |
| InChIKey | IEGHFRVJVGXHAN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |