C16H29NO7S — CID 87332483
tert-butyl 2-(3-ethoxy-3-oxopropyl)-5-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 87332483) has the molecular formula C16H29NO7S and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl 2-(3-ethoxy-3-oxopropyl)-5-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-ethoxy-3-oxopropyl)-5-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87332483 |
| Molecular Formula | C16H29NO7S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl 2-(3-ethoxy-3-oxopropyl)-5-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)CCC1CCC(OS(C)(=O)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO7S/c1-6-22-14(18)10-8-12-7-9-13(24-25(5,20)21)11-17(12)15(19)23-16(2,3)4/h12-13H,6-11H2,1-5H3 |
| InChIKey | DDRGZVCVAFGWBS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|