[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid

C9H6F5NO3 — CID 87333592

IUPAC[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid
SMILESO=C(O)Nc1ccccc1OC(F)(F)C(F)(F)F
InChIInChI=1S/C9H6F5NO3/c10-8(11,12)9(13,14)18-6-4-2-1-3-5(6)15-7(16)17/h1-4,15H,(H,16,17)
InChIKeyZRPSOGOKEJTWDD-UHFFFAOYSA-N
MW271.14 g/mol
LogP3.31
Rot. Bonds3

About [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid

[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid (PubChem CID 87333592) has the molecular formula C9H6F5NO3 and a molecular weight of 271.14 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid.

Molecular Properties

Compound Name[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid
PubChem CID87333592
Molecular FormulaC9H6F5NO3
Molecular Weight271.14 g/mol
Exact Mass271.03
IUPAC Name[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid
SMILESO=C(O)Nc1ccccc1OC(F)(F)C(F)(F)F
InChIInChI=1S/C9H6F5NO3/c10-8(11,12)9(13,14)18-6-4-2-1-3-5(6)15-7(16)17/h1-4,15H,(H,16,17)
InChIKeyZRPSOGOKEJTWDD-UHFFFAOYSA-N
XLogP3.31
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.14
LogP ≤ 53.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid?
The IUPAC name of [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid (CID 87333592) is [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid.
What is the SMILES notation for [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid?
The canonical SMILES for [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid is O=C(O)Nc1ccccc1OC(F)(F)C(F)(F)F.
What is the InChIKey of [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid?
The InChIKey is ZRPSOGOKEJTWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F5NO3/c10-8(11,12)9(13,14)18-6-4-2-1-3-5(6)15-7(16)17/h1-4,15H,(H,16,17).
What are the key properties of [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid?
[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid has a molecular weight of 271.14 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid is sourced from PubChem (CID 87333592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).