C9H6F5NO3 — CID 87333592
[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid (PubChem CID 87333592) has the molecular formula C9H6F5NO3 and a molecular weight of 271.14 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid.
| Compound Name | [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 87333592 |
| Molecular Formula | C9H6F5NO3 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [2-(1,1,2,2,2-pentafluoroethoxy)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO3/c10-8(11,12)9(13,14)18-6-4-2-1-3-5(6)15-7(16)17/h1-4,15H,(H,16,17) |
| InChIKey | ZRPSOGOKEJTWDD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|