C18H15ClF6N2O5 — CID 87336845
8-(2-chlorophenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87336845) has the molecular formula C18H15ClF6N2O5 and a molecular weight of 488.77 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-(2-chlorophenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87336845 |
| Molecular Formula | C18H15ClF6N2O5 |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 8-(2-chlorophenyl)-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Clc1ccccc1-c1ccc2c(n1)OCCNC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H13ClN2O.2C2HF3O2/c15-12-4-2-1-3-11(12)13-6-5-10-9-16-7-8-18-14(10)17-13;2*3-2(4,5)1(6)7/h1-6,16H,7-9H2;2*(H,6,7) |
| InChIKey | QBLDMIPFOWHCPS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |