About ethoxyethane;2-ethyloctanoic acid
ethoxyethane;2-ethyloctanoic acid (PubChem CID 87339497) has the molecular formula C14H30O3
and a molecular weight of 246.39 g/mol. Its IUPAC name is ethoxyethane;2-ethyloctanoic acid.
Molecular Properties
| Compound Name | ethoxyethane;2-ethyloctanoic acid |
| PubChem CID | 87339497 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | ethoxyethane;2-ethyloctanoic acid |
| SMILES | CCCCCCC(CC)C(=O)O.CCOCC |
| InChI | InChI=1S/C10H20O2.C4H10O/c1-3-5-6-7-8-9(4-2)10(11)12;1-3-5-4-2/h9H,3-8H2,1-2H3,(H,11,12);3-4H2,1-2H3 |
| InChIKey | NHIMUJQYHCLEHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;2-ethyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-ethyloctanoic acid?
The IUPAC name of ethoxyethane;2-ethyloctanoic acid (CID 87339497) is ethoxyethane;2-ethyloctanoic acid.
What is the SMILES notation for ethoxyethane;2-ethyloctanoic acid?
The canonical SMILES for ethoxyethane;2-ethyloctanoic acid is CCCCCCC(CC)C(=O)O.CCOCC.
What is the InChIKey of ethoxyethane;2-ethyloctanoic acid?
The InChIKey is NHIMUJQYHCLEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C4H10O/c1-3-5-6-7-8-9(4-2)10(11)12;1-3-5-4-2/h9H,3-8H2,1-2H3,(H,11,12);3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-ethyloctanoic acid?
ethoxyethane;2-ethyloctanoic acid has a molecular weight of 246.39 g/mol, XLogP of 4.11, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-ethyloctanoic acid is sourced from PubChem (CID 87339497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).