C11H20F2O2S — CID 87341062
2-(4,4-difluoropentylsulfanyl)-3,3-dimethylbutanoic acid (PubChem CID 87341062) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(4,4-difluoropentylsulfanyl)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(4,4-difluoropentylsulfanyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87341062 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(4,4-difluoropentylsulfanyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(F)(F)CCCSC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H20F2O2S/c1-10(2,3)8(9(14)15)16-7-5-6-11(4,12)13/h8H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | ZPHNHBADIMBUCV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|