C11H20F2O2S — CID 87341209
propyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate (PubChem CID 87341209) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is propyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate.
| Compound Name | propyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 87341209 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | propyl 2-(3,3-difluoropropylsulfanyl)-3-methylbutanoate |
| SMILES | CCCOC(=O)C(SCCC(F)F)C(C)C |
| InChI | InChI=1S/C11H20F2O2S/c1-4-6-15-11(14)10(8(2)3)16-7-5-9(12)13/h8-10H,4-7H2,1-3H3 |
| InChIKey | NKYXLHRGJYOXFC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |