About 2-methylpropyl 2-sulfanylpentanoate
2-methylpropyl 2-sulfanylpentanoate (PubChem CID 87341273) has the molecular formula C9H18O2S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-methylpropyl 2-sulfanylpentanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-sulfanylpentanoate |
| PubChem CID | 87341273 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-methylpropyl 2-sulfanylpentanoate |
| SMILES | CCCC(S)C(=O)OCC(C)C |
| InChI | InChI=1S/C9H18O2S/c1-4-5-8(12)9(10)11-6-7(2)3/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | AOWRTHJZFTYACP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-sulfanylpentanoate?
The IUPAC name of 2-methylpropyl 2-sulfanylpentanoate (CID 87341273) is 2-methylpropyl 2-sulfanylpentanoate.
What is the SMILES notation for 2-methylpropyl 2-sulfanylpentanoate?
The canonical SMILES for 2-methylpropyl 2-sulfanylpentanoate is CCCC(S)C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-sulfanylpentanoate?
The InChIKey is AOWRTHJZFTYACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2S/c1-4-5-8(12)9(10)11-6-7(2)3/h7-8,12H,4-6H2,1-3H3.
What are the key properties of 2-methylpropyl 2-sulfanylpentanoate?
2-methylpropyl 2-sulfanylpentanoate has a molecular weight of 190.31 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-sulfanylpentanoate is sourced from PubChem (CID 87341273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).