About 2-ethoxypropyl 2-sulfanylpropanoate
2-ethoxypropyl 2-sulfanylpropanoate (PubChem CID 91229316) has the molecular formula C8H16O3S
and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-ethoxypropyl 2-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-ethoxypropyl 2-sulfanylpropanoate |
| PubChem CID | 91229316 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-ethoxypropyl 2-sulfanylpropanoate |
| SMILES | CCOC(C)COC(=O)C(C)S |
| InChI | InChI=1S/C8H16O3S/c1-4-10-6(2)5-11-8(9)7(3)12/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | NAVUWLCNSRFVKH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxypropyl 2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropyl 2-sulfanylpropanoate?
The IUPAC name of 2-ethoxypropyl 2-sulfanylpropanoate (CID 91229316) is 2-ethoxypropyl 2-sulfanylpropanoate.
What is the SMILES notation for 2-ethoxypropyl 2-sulfanylpropanoate?
The canonical SMILES for 2-ethoxypropyl 2-sulfanylpropanoate is CCOC(C)COC(=O)C(C)S.
What is the InChIKey of 2-ethoxypropyl 2-sulfanylpropanoate?
The InChIKey is NAVUWLCNSRFVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S/c1-4-10-6(2)5-11-8(9)7(3)12/h6-7,12H,4-5H2,1-3H3.
What are the key properties of 2-ethoxypropyl 2-sulfanylpropanoate?
2-ethoxypropyl 2-sulfanylpropanoate has a molecular weight of 192.28 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropyl 2-sulfanylpropanoate is sourced from PubChem (CID 91229316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).