C15H14BrClN2O3 — CID 87342361
methyl 3-bromo-6-chloro-4-[(2-methoxyphenyl)methylamino]pyridine-2-carboxylate (PubChem CID 87342361) has the molecular formula C15H14BrClN2O3 and a molecular weight of 385.65 g/mol. Its IUPAC name is methyl 3-bromo-6-chloro-4-[(2-methoxyphenyl)methylamino]pyridine-2-carboxylate.
| Compound Name | methyl 3-bromo-6-chloro-4-[(2-methoxyphenyl)methylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 87342361 |
| Molecular Formula | C15H14BrClN2O3 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | methyl 3-bromo-6-chloro-4-[(2-methoxyphenyl)methylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)cc(NCc2ccccc2OC)c1Br |
| InChI | InChI=1S/C15H14BrClN2O3/c1-21-11-6-4-3-5-9(11)8-18-10-7-12(17)19-14(13(10)16)15(20)22-2/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | WRQPDXMBTOVOHF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|