C16H13Cl3N2O2 — CID 87340428
methyl 6-chloro-4-[(2,6-dichlorophenyl)methylamino]-3-ethenylpyridine-2-carboxylate (PubChem CID 87340428) has the molecular formula C16H13Cl3N2O2 and a molecular weight of 371.65 g/mol. Its IUPAC name is methyl 6-chloro-4-[(2,6-dichlorophenyl)methylamino]-3-ethenylpyridine-2-carboxylate.
| Compound Name | methyl 6-chloro-4-[(2,6-dichlorophenyl)methylamino]-3-ethenylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 87340428 |
| Molecular Formula | C16H13Cl3N2O2 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | methyl 6-chloro-4-[(2,6-dichlorophenyl)methylamino]-3-ethenylpyridine-2-carboxylate |
| SMILES | C=Cc1c(NCc2c(Cl)cccc2Cl)cc(Cl)nc1C(=O)OC |
| InChI | InChI=1S/C16H13Cl3N2O2/c1-3-9-13(7-14(19)21-15(9)16(22)23-2)20-8-10-11(17)5-4-6-12(10)18/h3-7H,1,8H2,2H3,(H,20,21) |
| InChIKey | LPKXHHJBDOUJJX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|