C12H15N3O2S — CID 87343306
N-[6-(dimethylaminomethylidene)-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]acetamide (PubChem CID 87343306) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-[6-(dimethylaminomethylidene)-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-(dimethylaminomethylidene)-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87343306 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-[6-(dimethylaminomethylidene)-7-oxo-4,5-dihydro-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)C(=O)C(=CN(C)C)CC2 |
| InChI | InChI=1S/C12H15N3O2S/c1-7(16)13-12-14-9-5-4-8(6-15(2)3)10(17)11(9)18-12/h6H,4-5H2,1-3H3,(H,13,14,16) |
| InChIKey | BHPFBHBBRWHSAS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|