C12H14N2O4S — CID 159958847
2-acetamido-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-6-carboxylic acid;ethene (PubChem CID 159958847) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-acetamido-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-6-carboxylic acid;ethene.
| Compound Name | 2-acetamido-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-6-carboxylic acid;ethene |
|---|---|
| PubChem CID | 159958847 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-acetamido-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-6-carboxylic acid;ethene |
| SMILES | C=C.CC(=O)Nc1nc2c(s1)C(=O)C(C(=O)O)CC2 |
| InChI | InChI=1S/C10H10N2O4S.C2H4/c1-4(13)11-10-12-6-3-2-5(9(15)16)7(14)8(6)17-10;1-2/h5H,2-3H2,1H3,(H,15,16)(H,11,12,13);1-2H2 |
| InChIKey | ODBFQVSTTBWSOG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|