C16H13N3O5S — CID 99647166
N-[(6R)-6-(3-nitrobenzoyl)-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide (PubChem CID 99647166) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is N-[(6R)-6-(3-nitrobenzoyl)-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[(6R)-6-(3-nitrobenzoyl)-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 99647166 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(6R)-6-(3-nitrobenzoyl)-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)C(=O)[C@@H](C(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C16H13N3O5S/c1-8(20)17-16-18-12-6-5-11(14(22)15(12)25-16)13(21)9-3-2-4-10(7-9)19(23)24/h2-4,7,11H,5-6H2,1H3,(H,17,18,20)/t11-/m1/s1 |
| InChIKey | JDMNMMLFCIQQME-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|