C19H22N4O3S — CID 123837792
N-[6-[6-(tert-butylamino)pyridine-3-carbonyl]-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide (PubChem CID 123837792) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[6-[6-(tert-butylamino)pyridine-3-carbonyl]-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[6-(tert-butylamino)pyridine-3-carbonyl]-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 123837792 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[6-[6-(tert-butylamino)pyridine-3-carbonyl]-7-oxo-5,6-dihydro-4H-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)C(=O)C(C(=O)c1ccc(NC(C)(C)C)nc1)CC2 |
| InChI | InChI=1S/C19H22N4O3S/c1-10(24)21-18-22-13-7-6-12(16(26)17(13)27-18)15(25)11-5-8-14(20-9-11)23-19(2,3)4/h5,8-9,12H,6-7H2,1-4H3,(H,20,23)(H,21,22,24) |
| InChIKey | WFZYBEDPBUJMOG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|