C14H25NO3 — CID 87343876
butyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide (PubChem CID 87343876) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide.
| Compound Name | butyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 87343876 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | butyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)NC(C)C |
| InChI | InChI=1S/C8H14O2.C6H11NO/c1-4-5-6-10-8(9)7(2)3;1-4-6(8)7-5(2)3/h2,4-6H2,1,3H3;4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | SKSRXOOFNAWNDJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|